C20H22Cl2N2O3S — CID 71540946
N-(3,4-dichlorophenyl)-1-(2,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 71540946) has the molecular formula C20H22Cl2N2O3S and a molecular weight of 441.38 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-(2,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-1-(2,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 71540946 |
| Molecular Formula | C20H22Cl2N2O3S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-(2,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)Nc3ccc(Cl)c(Cl)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H22Cl2N2O3S/c1-13-3-6-19(14(2)11-13)28(26,27)24-9-7-15(8-10-24)20(25)23-16-4-5-17(21)18(22)12-16/h3-6,11-12,15H,7-10H2,1-2H3,(H,23,25) |
| InChIKey | JHAGPLHTNPSPQH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |