C20H23BrN2O3S — CID 26914002
N-(3-bromophenyl)-1-(2,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 26914002) has the molecular formula C20H23BrN2O3S and a molecular weight of 451.39 g/mol. Its IUPAC name is N-(3-bromophenyl)-1-(2,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3-bromophenyl)-1-(2,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26914002 |
| Molecular Formula | C20H23BrN2O3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N-(3-bromophenyl)-1-(2,4-dimethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)Nc3cccc(Br)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H23BrN2O3S/c1-14-6-7-19(15(2)12-14)27(25,26)23-10-8-16(9-11-23)20(24)22-18-5-3-4-17(21)13-18/h3-7,12-13,16H,8-11H2,1-2H3,(H,22,24) |
| InChIKey | KMVGSWUXEOFIFV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |