C18H17BrF2N2O3S — CID 46823369
N-(3-bromophenyl)-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 46823369) has the molecular formula C18H17BrF2N2O3S and a molecular weight of 459.31 g/mol. Its IUPAC name is N-(3-bromophenyl)-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3-bromophenyl)-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46823369 |
| Molecular Formula | C18H17BrF2N2O3S |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | N-(3-bromophenyl)-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C18H17BrF2N2O3S/c19-13-2-1-3-15(10-13)22-18(24)12-6-8-23(9-7-12)27(25,26)17-11-14(20)4-5-16(17)21/h1-5,10-12H,6-9H2,(H,22,24) |
| InChIKey | DNIAYOZTZCEXPW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |