C20H18F2N2O3S — CID 55514825
1-(2,5-difluorophenyl)sulfonyl-N-(3-ethynylphenyl)piperidine-4-carboxamide (PubChem CID 55514825) has the molecular formula C20H18F2N2O3S and a molecular weight of 404.44 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfonyl-N-(3-ethynylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,5-difluorophenyl)sulfonyl-N-(3-ethynylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55514825 |
| Molecular Formula | C20H18F2N2O3S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfonyl-N-(3-ethynylphenyl)piperidine-4-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)C2CCN(S(=O)(=O)c3cc(F)ccc3F)CC2)c1 |
| InChI | InChI=1S/C20H18F2N2O3S/c1-2-14-4-3-5-17(12-14)23-20(25)15-8-10-24(11-9-15)28(26,27)19-13-16(21)6-7-18(19)22/h1,3-7,12-13,15H,8-11H2,(H,23,25) |
| InChIKey | CZZAVZOPDIDSRM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|