C21H23N3O3S — CID 100780352
N-(3-cyanophenyl)-1-(2,5-dimethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 100780352) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-(3-cyanophenyl)-1-(2,5-dimethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3-cyanophenyl)-1-(2,5-dimethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 100780352 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-(3-cyanophenyl)-1-(2,5-dimethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC(C(=O)Nc3cccc(C#N)c3)CC2)c1 |
| InChI | InChI=1S/C21H23N3O3S/c1-15-6-7-16(2)20(12-15)28(26,27)24-10-8-18(9-11-24)21(25)23-19-5-3-4-17(13-19)14-22/h3-7,12-13,18H,8-11H2,1-2H3,(H,23,25) |
| InChIKey | HGTKAUWBXOMMMM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |