C21H24N4O5S2 — CID 24503873
1-(4-cyanophenyl)sulfonyl-N-[4-methyl-3-(methylsulfamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 24503873) has the molecular formula C21H24N4O5S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 1-(4-cyanophenyl)sulfonyl-N-[4-methyl-3-(methylsulfamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-cyanophenyl)sulfonyl-N-[4-methyl-3-(methylsulfamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24503873 |
| Molecular Formula | C21H24N4O5S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 1-(4-cyanophenyl)sulfonyl-N-[4-methyl-3-(methylsulfamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C#N)cc3)CC2)ccc1C |
| InChI | InChI=1S/C21H24N4O5S2/c1-15-3-6-18(13-20(15)31(27,28)23-2)24-21(26)17-9-11-25(12-10-17)32(29,30)19-7-4-16(14-22)5-8-19/h3-8,13,17,23H,9-12H2,1-2H3,(H,24,26) |
| InChIKey | DTTQDNWQQIGTSQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |