C25H31N3O5S — CID 26705393
1-(4-cyanophenyl)sulfonyl-N-(3,4-dipropoxyphenyl)piperidine-4-carboxamide (PubChem CID 26705393) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is 1-(4-cyanophenyl)sulfonyl-N-(3,4-dipropoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-cyanophenyl)sulfonyl-N-(3,4-dipropoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26705393 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 1-(4-cyanophenyl)sulfonyl-N-(3,4-dipropoxyphenyl)piperidine-4-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C#N)cc3)CC2)cc1OCCC |
| InChI | InChI=1S/C25H31N3O5S/c1-3-15-32-23-10-7-21(17-24(23)33-16-4-2)27-25(29)20-11-13-28(14-12-20)34(30,31)22-8-5-19(18-26)6-9-22/h5-10,17,20H,3-4,11-16H2,1-2H3,(H,27,29) |
| InChIKey | XBCVSSRLBCETSF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |