C23H27N3O3S — CID 26289870
1-(4-tert-butylphenyl)sulfonyl-N-(4-cyanophenyl)piperidine-4-carboxamide (PubChem CID 26289870) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-N-(4-cyanophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-N-(4-cyanophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26289870 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-N-(4-cyanophenyl)piperidine-4-carboxamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCC(C(=O)Nc3ccc(C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-23(2,3)19-6-10-21(11-7-19)30(28,29)26-14-12-18(13-15-26)22(27)25-20-8-4-17(16-24)5-9-20/h4-11,18H,12-15H2,1-3H3,(H,25,27) |
| InChIKey | YEKOHOPGIHAZGN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |