C19H17Cl2N3O3S — CID 26727729
N-(3-cyanophenyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 26727729) has the molecular formula C19H17Cl2N3O3S and a molecular weight of 438.34 g/mol. Its IUPAC name is N-(3-cyanophenyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3-cyanophenyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26727729 |
| Molecular Formula | C19H17Cl2N3O3S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | N-(3-cyanophenyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)C2CCN(S(=O)(=O)c3c(Cl)cccc3Cl)CC2)c1 |
| InChI | InChI=1S/C19H17Cl2N3O3S/c20-16-5-2-6-17(21)18(16)28(26,27)24-9-7-14(8-10-24)19(25)23-15-4-1-3-13(11-15)12-22/h1-6,11,14H,7-10H2,(H,23,25) |
| InChIKey | WPZYZHPHWGJFST-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |