C21H19F2N3O2 — CID 109151170
4-N-(3-cyanophenyl)-1-N-(3,4-difluorophenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109151170) has the molecular formula C21H19F2N3O2 and a molecular weight of 383.40 g/mol. Its IUPAC name is 4-N-(3-cyanophenyl)-1-N-(3,4-difluorophenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(3-cyanophenyl)-1-N-(3,4-difluorophenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109151170 |
| Molecular Formula | C21H19F2N3O2 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 4-N-(3-cyanophenyl)-1-N-(3,4-difluorophenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | N#Cc1cccc(NC(=O)C2CCC(C(=O)Nc3ccc(F)c(F)c3)CC2)c1 |
| InChI | InChI=1S/C21H19F2N3O2/c22-18-9-8-17(11-19(18)23)26-21(28)15-6-4-14(5-7-15)20(27)25-16-3-1-2-13(10-16)12-24/h1-3,8-11,14-15H,4-7H2,(H,25,27)(H,26,28) |
| InChIKey | GZWGKAPWZAWTRL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |