C13H16F2N2O — CID 60847397
4-amino-N-(3,4-difluorophenyl)cyclohexane-1-carboxamide (PubChem CID 60847397) has the molecular formula C13H16F2N2O and a molecular weight of 254.28 g/mol. Its IUPAC name is 4-amino-N-(3,4-difluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-(3,4-difluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 60847397 |
| Molecular Formula | C13H16F2N2O |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 4-amino-N-(3,4-difluorophenyl)cyclohexane-1-carboxamide |
| SMILES | NC1CCC(C(=O)Nc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C13H16F2N2O/c14-11-6-5-10(7-12(11)15)17-13(18)8-1-3-9(16)4-2-8/h5-9H,1-4,16H2,(H,17,18) |
| InChIKey | KGUFCDDPMZZFRN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |