C19H19F3N2O — CID 167830419
4-amino-N-[4-(3,4,5-trifluorophenyl)phenyl]cyclohexane-1-carboxamide (PubChem CID 167830419) has the molecular formula C19H19F3N2O and a molecular weight of 348.37 g/mol. Its IUPAC name is 4-amino-N-[4-(3,4,5-trifluorophenyl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-[4-(3,4,5-trifluorophenyl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 167830419 |
| Molecular Formula | C19H19F3N2O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-amino-N-[4-(3,4,5-trifluorophenyl)phenyl]cyclohexane-1-carboxamide |
| SMILES | NC1CCC(C(=O)Nc2ccc(-c3cc(F)c(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C19H19F3N2O/c20-16-9-13(10-17(21)18(16)22)11-3-7-15(8-4-11)24-19(25)12-1-5-14(23)6-2-12/h3-4,7-10,12,14H,1-2,5-6,23H2,(H,24,25) |
| InChIKey | KJFQTUPSHIPTAH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|