C13H14F4N2O — CID 107641715
4-amino-N-(2,3,5,6-tetrafluorophenyl)cyclohexane-1-carboxamide (PubChem CID 107641715) has the molecular formula C13H14F4N2O and a molecular weight of 290.26 g/mol. Its IUPAC name is 4-amino-N-(2,3,5,6-tetrafluorophenyl)cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-(2,3,5,6-tetrafluorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107641715 |
| Molecular Formula | C13H14F4N2O |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 4-amino-N-(2,3,5,6-tetrafluorophenyl)cyclohexane-1-carboxamide |
| SMILES | NC1CCC(C(=O)Nc2c(F)c(F)cc(F)c2F)CC1 |
| InChI | InChI=1S/C13H14F4N2O/c14-8-5-9(15)11(17)12(10(8)16)19-13(20)6-1-3-7(18)4-2-6/h5-7H,1-4,18H2,(H,19,20) |
| InChIKey | YNKJSSWJRQARMD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|