C11H10F4N2O — CID 107641757
(2R)-N-(2,3,5,6-tetrafluorophenyl)pyrrolidine-2-carboxamide (PubChem CID 107641757) has the molecular formula C11H10F4N2O and a molecular weight of 262.21 g/mol. Its IUPAC name is (2R)-N-(2,3,5,6-tetrafluorophenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(2,3,5,6-tetrafluorophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 107641757 |
| Molecular Formula | C11H10F4N2O |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | (2R)-N-(2,3,5,6-tetrafluorophenyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)cc(F)c1F)[C@H]1CCCN1 |
| InChI | InChI=1S/C11H10F4N2O/c12-5-4-6(13)9(15)10(8(5)14)17-11(18)7-2-1-3-16-7/h4,7,16H,1-3H2,(H,17,18)/t7-/m1/s1 |
| InChIKey | AQJCCYPWJQJRHZ-SSDOTTSWSA-N |
| XLogP | 1.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|