C11H12F2N2O — CID 43124050
N-(2,6-difluorophenyl)pyrrolidine-2-carboxamide (PubChem CID 43124050) has the molecular formula C11H12F2N2O and a molecular weight of 226.23 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43124050 |
| Molecular Formula | C11H12F2N2O |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-(2,6-difluorophenyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)C1CCCN1 |
| InChI | InChI=1S/C11H12F2N2O/c12-7-3-1-4-8(13)10(7)15-11(16)9-5-2-6-14-9/h1,3-4,9,14H,2,5-6H2,(H,15,16) |
| InChIKey | AWHPRLLPTYRHEW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |