C12H16ClFN2O — CID 119281809
N-(3-fluoro-2-methylphenyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119281809) has the molecular formula C12H16ClFN2O and a molecular weight of 258.72 g/mol. Its IUPAC name is N-(3-fluoro-2-methylphenyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-(3-fluoro-2-methylphenyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119281809 |
| Molecular Formula | C12H16ClFN2O |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | N-(3-fluoro-2-methylphenyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cc1c(F)cccc1NC(=O)C1CCCN1.Cl |
| InChI | InChI=1S/C12H15FN2O.ClH/c1-8-9(13)4-2-5-10(8)15-12(16)11-6-3-7-14-11;/h2,4-5,11,14H,3,6-7H2,1H3,(H,15,16);1H |
| InChIKey | DXEFEUYHLHKLHW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |