C11H12ClF2IN2O — CID 119312522
N-(3,5-difluoro-4-iodophenyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119312522) has the molecular formula C11H12ClF2IN2O and a molecular weight of 388.58 g/mol. Its IUPAC name is N-(3,5-difluoro-4-iodophenyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-(3,5-difluoro-4-iodophenyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119312522 |
| Molecular Formula | C11H12ClF2IN2O |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | N-(3,5-difluoro-4-iodophenyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cc(F)c(I)c(F)c1)C1CCCN1 |
| InChI | InChI=1S/C11H11F2IN2O.ClH/c12-7-4-6(5-8(13)10(7)14)16-11(17)9-2-1-3-15-9;/h4-5,9,15H,1-3H2,(H,16,17);1H |
| InChIKey | SGWKANCDUKNGRH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|