C12H13F2IN2O — CID 119312519
N-(3,5-difluoro-4-iodophenyl)piperidine-4-carboxamide (PubChem CID 119312519) has the molecular formula C12H13F2IN2O and a molecular weight of 366.15 g/mol. Its IUPAC name is N-(3,5-difluoro-4-iodophenyl)piperidine-4-carboxamide.
| Compound Name | N-(3,5-difluoro-4-iodophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119312519 |
| Molecular Formula | C12H13F2IN2O |
| Molecular Weight | 366.15 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | N-(3,5-difluoro-4-iodophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(F)c(I)c(F)c1)C1CCNCC1 |
| InChI | InChI=1S/C12H13F2IN2O/c13-9-5-8(6-10(14)11(9)15)17-12(18)7-1-3-16-4-2-7/h5-7,16H,1-4H2,(H,17,18) |
| InChIKey | ICOHYVIMNSDXSW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|