C11H12ClF3N2O — CID 119708015
N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119708015) has the molecular formula C11H12ClF3N2O and a molecular weight of 280.68 g/mol. Its IUPAC name is N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119708015 |
| Molecular Formula | C11H12ClF3N2O |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cc(F)c(F)c(F)c1)C1CCNC1 |
| InChI | InChI=1S/C11H11F3N2O.ClH/c12-8-3-7(4-9(13)10(8)14)16-11(17)6-1-2-15-5-6;/h3-4,6,15H,1-2,5H2,(H,16,17);1H |
| InChIKey | SIZOYGCVQPFFBY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|