C13H15F3N2O2 — CID 60927755
N-[4-(difluoromethoxy)-3-fluorophenyl]piperidine-4-carboxamide (PubChem CID 60927755) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-3-fluorophenyl]piperidine-4-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)-3-fluorophenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60927755 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-[4-(difluoromethoxy)-3-fluorophenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)c(F)c1)C1CCNCC1 |
| InChI | InChI=1S/C13H15F3N2O2/c14-10-7-9(1-2-11(10)20-13(15)16)18-12(19)8-3-5-17-6-4-8/h1-2,7-8,13,17H,3-6H2,(H,18,19) |
| InChIKey | AODLWZNQEKFUPR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |