C13H13F3N2O3 — CID 112732263
N-[4-(difluoromethoxy)-3-fluorophenyl]-6-oxopiperidine-3-carboxamide (PubChem CID 112732263) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-3-fluorophenyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)-3-fluorophenyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 112732263 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[4-(difluoromethoxy)-3-fluorophenyl]-6-oxopiperidine-3-carboxamide |
| SMILES | O=C1CCC(C(=O)Nc2ccc(OC(F)F)c(F)c2)CN1 |
| InChI | InChI=1S/C13H13F3N2O3/c14-9-5-8(2-3-10(9)21-13(15)16)18-12(20)7-1-4-11(19)17-6-7/h2-3,5,7,13H,1,4,6H2,(H,17,19)(H,18,20) |
| InChIKey | AGDMXIITVKZUCT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |