C16H16FN3O2 — CID 96501783
(3R)-N-(4-fluoro-3-pyrrol-1-ylphenyl)-6-oxopiperidine-3-carboxamide (PubChem CID 96501783) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is (3R)-N-(4-fluoro-3-pyrrol-1-ylphenyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | (3R)-N-(4-fluoro-3-pyrrol-1-ylphenyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 96501783 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (3R)-N-(4-fluoro-3-pyrrol-1-ylphenyl)-6-oxopiperidine-3-carboxamide |
| SMILES | O=C1CC[C@@H](C(=O)Nc2ccc(F)c(-n3cccc3)c2)CN1 |
| InChI | InChI=1S/C16H16FN3O2/c17-13-5-4-12(9-14(13)20-7-1-2-8-20)19-16(22)11-3-6-15(21)18-10-11/h1-2,4-5,7-9,11H,3,6,10H2,(H,18,21)(H,19,22)/t11-/m1/s1 |
| InChIKey | PYAZYGBTDDTYKW-LLVKDONJSA-N |
| XLogP | 2.08 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |