C19H18N2O2 — CID 71941186
N-(9H-fluoren-2-yl)-6-oxopiperidine-3-carboxamide (PubChem CID 71941186) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-(9H-fluoren-2-yl)-6-oxopiperidine-3-carboxamide.
| Compound Name | N-(9H-fluoren-2-yl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 71941186 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-(9H-fluoren-2-yl)-6-oxopiperidine-3-carboxamide |
| SMILES | O=C1CCC(C(=O)Nc2ccc3c(c2)Cc2ccccc2-3)CN1 |
| InChI | InChI=1S/C19H18N2O2/c22-18-8-5-13(11-20-18)19(23)21-15-6-7-17-14(10-15)9-12-3-1-2-4-16(12)17/h1-4,6-7,10,13H,5,8-9,11H2,(H,20,22)(H,21,23) |
| InChIKey | KZQNICZZWPATGU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |