C25H23FN2O3S — CID 24637031
N-(9H-fluoren-2-yl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 24637031) has the molecular formula C25H23FN2O3S and a molecular weight of 450.54 g/mol. Its IUPAC name is N-(9H-fluoren-2-yl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(9H-fluoren-2-yl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24637031 |
| Molecular Formula | C25H23FN2O3S |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-(9H-fluoren-2-yl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)Cc1ccccc1-2)C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H23FN2O3S/c26-23-7-3-4-8-24(23)32(30,31)28-13-11-17(12-14-28)25(29)27-20-9-10-22-19(16-20)15-18-5-1-2-6-21(18)22/h1-10,16-17H,11-15H2,(H,27,29) |
| InChIKey | JGOCTISFIMEPAJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |