C18H21ClFN3O3S — CID 119422130
N-(2-aminophenyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 119422130) has the molecular formula C18H21ClFN3O3S and a molecular weight of 413.90 g/mol. Its IUPAC name is N-(2-aminophenyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-(2-aminophenyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119422130 |
| Molecular Formula | C18H21ClFN3O3S |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-(2-aminophenyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.Nc1ccccc1NC(=O)C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H20FN3O3S.ClH/c19-14-5-1-4-8-17(14)26(24,25)22-11-9-13(10-12-22)18(23)21-16-7-3-2-6-15(16)20;/h1-8,13H,9-12,20H2,(H,21,23);1H |
| InChIKey | XHUJSGMYGIGGSY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|