C15H23ClFN3O3S — CID 119501151
1-(2-fluorophenyl)sulfonyl-N-[2-(methylamino)ethyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 119501151) has the molecular formula C15H23ClFN3O3S and a molecular weight of 379.89 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfonyl-N-[2-(methylamino)ethyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-(2-fluorophenyl)sulfonyl-N-[2-(methylamino)ethyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119501151 |
| Molecular Formula | C15H23ClFN3O3S |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-(2-fluorophenyl)sulfonyl-N-[2-(methylamino)ethyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)C1CCN(S(=O)(=O)c2ccccc2F)CC1.Cl |
| InChI | InChI=1S/C15H22FN3O3S.ClH/c1-17-8-9-18-15(20)12-6-10-19(11-7-12)23(21,22)14-5-3-2-4-13(14)16;/h2-5,12,17H,6-11H2,1H3,(H,18,20);1H |
| InChIKey | OPHPIXYODHVZDM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|