C23H30FN3O3S — CID 55535881
N-(2-anilino-3-methylbutyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 55535881) has the molecular formula C23H30FN3O3S and a molecular weight of 447.58 g/mol. Its IUPAC name is N-(2-anilino-3-methylbutyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-anilino-3-methylbutyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55535881 |
| Molecular Formula | C23H30FN3O3S |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-(2-anilino-3-methylbutyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CC(C)C(CNC(=O)C1CCN(S(=O)(=O)c2ccccc2F)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C23H30FN3O3S/c1-17(2)21(26-19-8-4-3-5-9-19)16-25-23(28)18-12-14-27(15-13-18)31(29,30)22-11-7-6-10-20(22)24/h3-11,17-18,21,26H,12-16H2,1-2H3,(H,25,28) |
| InChIKey | JCCVICIANZRJEF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |