C21H25FN2O5S — CID 24504256
1-(2-fluorophenyl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]piperidine-4-carboxamide (PubChem CID 24504256) has the molecular formula C21H25FN2O5S and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24504256 |
| Molecular Formula | C21H25FN2O5S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 1-(2-fluorophenyl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)C2CCN(S(=O)(=O)c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C21H25FN2O5S/c1-28-17-6-8-18(9-7-17)29-15-12-23-21(25)16-10-13-24(14-11-16)30(26,27)20-5-3-2-4-19(20)22/h2-9,16H,10-15H2,1H3,(H,23,25) |
| InChIKey | WCINLUCBXMAWMN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|