C20H28FN3O4S — CID 39512997
1-(2-fluorophenyl)sulfonyl-N-[2-(2-oxoazepan-1-yl)ethyl]piperidine-4-carboxamide (PubChem CID 39512997) has the molecular formula C20H28FN3O4S and a molecular weight of 425.53 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfonyl-N-[2-(2-oxoazepan-1-yl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)sulfonyl-N-[2-(2-oxoazepan-1-yl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 39512997 |
| Molecular Formula | C20H28FN3O4S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 1-(2-fluorophenyl)sulfonyl-N-[2-(2-oxoazepan-1-yl)ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCN1CCCCCC1=O)C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H28FN3O4S/c21-17-6-3-4-7-18(17)29(27,28)24-13-9-16(10-14-24)20(26)22-11-15-23-12-5-1-2-8-19(23)25/h3-4,6-7,16H,1-2,5,8-15H2,(H,22,26) |
| InChIKey | HZCUIMFORILSLP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |