C20H28FN3O4S — CID 46596810
4-fluoro-N-[3-(2-oxoazepan-1-yl)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 46596810) has the molecular formula C20H28FN3O4S and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-fluoro-N-[3-(2-oxoazepan-1-yl)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-fluoro-N-[3-(2-oxoazepan-1-yl)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46596810 |
| Molecular Formula | C20H28FN3O4S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 4-fluoro-N-[3-(2-oxoazepan-1-yl)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCCN1CCCCCC1=O)c1ccc(F)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H28FN3O4S/c21-17-9-8-16(15-18(17)29(27,28)24-13-4-5-14-24)20(26)22-10-6-12-23-11-3-1-2-7-19(23)25/h8-9,15H,1-7,10-14H2,(H,22,26) |
| InChIKey | XESJMPDQQLVQIU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|