C26H26F2N2O3S — CID 27770594
1-(2,5-difluorophenyl)sulfonyl-N-(2,2-diphenylethyl)piperidine-4-carboxamide (PubChem CID 27770594) has the molecular formula C26H26F2N2O3S and a molecular weight of 484.57 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfonyl-N-(2,2-diphenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,5-difluorophenyl)sulfonyl-N-(2,2-diphenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27770594 |
| Molecular Formula | C26H26F2N2O3S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfonyl-N-(2,2-diphenylethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)c1ccccc1)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C26H26F2N2O3S/c27-22-11-12-24(28)25(17-22)34(32,33)30-15-13-21(14-16-30)26(31)29-18-23(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-12,17,21,23H,13-16,18H2,(H,29,31) |
| InChIKey | DHOXVIVPXFPXCS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |