C24H23F2N3O4S — CID 25410031
1-(2,5-difluorophenyl)sulfonyl-N'-(2-naphthalen-1-ylacetyl)piperidine-4-carbohydrazide (PubChem CID 25410031) has the molecular formula C24H23F2N3O4S and a molecular weight of 487.53 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfonyl-N'-(2-naphthalen-1-ylacetyl)piperidine-4-carbohydrazide.
| Compound Name | 1-(2,5-difluorophenyl)sulfonyl-N'-(2-naphthalen-1-ylacetyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 25410031 |
| Molecular Formula | C24H23F2N3O4S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfonyl-N'-(2-naphthalen-1-ylacetyl)piperidine-4-carbohydrazide |
| SMILES | O=C(Cc1cccc2ccccc12)NNC(=O)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C24H23F2N3O4S/c25-19-8-9-21(26)22(15-19)34(32,33)29-12-10-17(11-13-29)24(31)28-27-23(30)14-18-6-3-5-16-4-1-2-7-20(16)18/h1-9,15,17H,10-14H2,(H,27,30)(H,28,31) |
| InChIKey | KCBSDSKTCLGSNU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|