C22H21FN2O3S — CID 26688330
1-(2-fluorophenyl)sulfonyl-N-naphthalen-1-ylpiperidine-4-carboxamide (PubChem CID 26688330) has the molecular formula C22H21FN2O3S and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfonyl-N-naphthalen-1-ylpiperidine-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)sulfonyl-N-naphthalen-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26688330 |
| Molecular Formula | C22H21FN2O3S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1-(2-fluorophenyl)sulfonyl-N-naphthalen-1-ylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H21FN2O3S/c23-19-9-3-4-11-21(19)29(27,28)25-14-12-17(13-15-25)22(26)24-20-10-5-7-16-6-1-2-8-18(16)20/h1-11,17H,12-15H2,(H,24,26) |
| InChIKey | QCUULFJYAHFKFL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |