C19H19Cl2FN2O3S — CID 92642655
1-[(2-chloro-6-fluorophenyl)methylsulfonyl]-N-(2-chlorophenyl)piperidine-4-carboxamide (PubChem CID 92642655) has the molecular formula C19H19Cl2FN2O3S and a molecular weight of 445.34 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methylsulfonyl]-N-(2-chlorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methylsulfonyl]-N-(2-chlorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92642655 |
| Molecular Formula | C19H19Cl2FN2O3S |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methylsulfonyl]-N-(2-chlorophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)C1CCN(S(=O)(=O)Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C19H19Cl2FN2O3S/c20-15-5-3-6-17(22)14(15)12-28(26,27)24-10-8-13(9-11-24)19(25)23-18-7-2-1-4-16(18)21/h1-7,13H,8-12H2,(H,23,25) |
| InChIKey | MKFSXBHLBZMIPW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |