C20H22FN3O4S — CID 28577038
N-(2-carbamoylphenyl)-1-[(2-fluorophenyl)methylsulfonyl]piperidine-4-carboxamide (PubChem CID 28577038) has the molecular formula C20H22FN3O4S and a molecular weight of 419.48 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-1-[(2-fluorophenyl)methylsulfonyl]piperidine-4-carboxamide.
| Compound Name | N-(2-carbamoylphenyl)-1-[(2-fluorophenyl)methylsulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 28577038 |
| Molecular Formula | C20H22FN3O4S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-(2-carbamoylphenyl)-1-[(2-fluorophenyl)methylsulfonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)c1ccccc1NC(=O)C1CCN(S(=O)(=O)Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C20H22FN3O4S/c21-17-7-3-1-5-15(17)13-29(27,28)24-11-9-14(10-12-24)20(26)23-18-8-4-2-6-16(18)19(22)25/h1-8,14H,9-13H2,(H2,22,25)(H,23,26) |
| InChIKey | YWIHRCLHTPSUNO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |