C18H27FN2O3S — CID 53283463
1-[(2-fluorophenyl)methylsulfonyl]-N-pentan-3-ylpiperidine-4-carboxamide (PubChem CID 53283463) has the molecular formula C18H27FN2O3S and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methylsulfonyl]-N-pentan-3-ylpiperidine-4-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methylsulfonyl]-N-pentan-3-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 53283463 |
| Molecular Formula | C18H27FN2O3S |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[(2-fluorophenyl)methylsulfonyl]-N-pentan-3-ylpiperidine-4-carboxamide |
| SMILES | CCC(CC)NC(=O)C1CCN(S(=O)(=O)Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C18H27FN2O3S/c1-3-16(4-2)20-18(22)14-9-11-21(12-10-14)25(23,24)13-15-7-5-6-8-17(15)19/h5-8,14,16H,3-4,9-13H2,1-2H3,(H,20,22) |
| InChIKey | LLFLSBYTYSTFOW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |