C25H23FN2O5S — CID 26413454
1-(2-fluorophenyl)sulfonyl-N-(2-methoxydibenzofuran-3-yl)piperidine-4-carboxamide (PubChem CID 26413454) has the molecular formula C25H23FN2O5S and a molecular weight of 482.53 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfonyl-N-(2-methoxydibenzofuran-3-yl)piperidine-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)sulfonyl-N-(2-methoxydibenzofuran-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26413454 |
| Molecular Formula | C25H23FN2O5S |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 1-(2-fluorophenyl)sulfonyl-N-(2-methoxydibenzofuran-3-yl)piperidine-4-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)C1CCN(S(=O)(=O)c3ccccc3F)CC1)oc1ccccc12 |
| InChI | InChI=1S/C25H23FN2O5S/c1-32-23-14-18-17-6-2-4-8-21(17)33-22(18)15-20(23)27-25(29)16-10-12-28(13-11-16)34(30,31)24-9-5-3-7-19(24)26/h2-9,14-16H,10-13H2,1H3,(H,27,29) |
| InChIKey | QXZRORCQRSSZRW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |