C24H22ClFN2O4S — CID 26185187
N-(5-chloro-2-phenoxyphenyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 26185187) has the molecular formula C24H22ClFN2O4S and a molecular weight of 488.97 g/mol. Its IUPAC name is N-(5-chloro-2-phenoxyphenyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-phenoxyphenyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26185187 |
| Molecular Formula | C24H22ClFN2O4S |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | N-(5-chloro-2-phenoxyphenyl)-1-(2-fluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Oc1ccccc1)C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H22ClFN2O4S/c25-18-10-11-22(32-19-6-2-1-3-7-19)21(16-18)27-24(29)17-12-14-28(15-13-17)33(30,31)23-9-5-4-8-20(23)26/h1-11,16-17H,12-15H2,(H,27,29) |
| InChIKey | NBZSYVJIRMHSSW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |