C25H24Cl2N2O2 — CID 43924914
N-(5-chloro-2-phenoxyphenyl)-1-[(4-chlorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 43924914) has the molecular formula C25H24Cl2N2O2 and a molecular weight of 455.39 g/mol. Its IUPAC name is N-(5-chloro-2-phenoxyphenyl)-1-[(4-chlorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(5-chloro-2-phenoxyphenyl)-1-[(4-chlorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43924914 |
| Molecular Formula | C25H24Cl2N2O2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-(5-chloro-2-phenoxyphenyl)-1-[(4-chlorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Oc1ccccc1)C1CCCN(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H24Cl2N2O2/c26-20-10-8-18(9-11-20)16-29-14-4-5-19(17-29)25(30)28-23-15-21(27)12-13-24(23)31-22-6-2-1-3-7-22/h1-3,6-13,15,19H,4-5,14,16-17H2,(H,28,30) |
| InChIKey | QEROVJACIVGLEM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |