C20H22ClN3O3 — CID 9304566
(3R)-1-[2-(5-chloro-2-phenoxyanilino)-2-oxoethyl]piperidine-3-carboxamide (PubChem CID 9304566) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is (3R)-1-[2-(5-chloro-2-phenoxyanilino)-2-oxoethyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-(5-chloro-2-phenoxyanilino)-2-oxoethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 9304566 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (3R)-1-[2-(5-chloro-2-phenoxyanilino)-2-oxoethyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(CC(=O)Nc2cc(Cl)ccc2Oc2ccccc2)C1 |
| InChI | InChI=1S/C20H22ClN3O3/c21-15-8-9-18(27-16-6-2-1-3-7-16)17(11-15)23-19(25)13-24-10-4-5-14(12-24)20(22)26/h1-3,6-9,11,14H,4-5,10,12-13H2,(H2,22,26)(H,23,25)/t14-/m1/s1 |
| InChIKey | HYIIZAIEMZSRQP-CQSZACIVSA-N |
| XLogP | 3.27 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |