C26H27ClN2O2 — CID 93486494
N-(5-chloro-2-phenoxyphenyl)-4-[[(3R)-3-methylpiperidin-1-yl]methyl]benzamide (PubChem CID 93486494) has the molecular formula C26H27ClN2O2 and a molecular weight of 434.97 g/mol. Its IUPAC name is N-(5-chloro-2-phenoxyphenyl)-4-[[(3R)-3-methylpiperidin-1-yl]methyl]benzamide.
| Compound Name | N-(5-chloro-2-phenoxyphenyl)-4-[[(3R)-3-methylpiperidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 93486494 |
| Molecular Formula | C26H27ClN2O2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-(5-chloro-2-phenoxyphenyl)-4-[[(3R)-3-methylpiperidin-1-yl]methyl]benzamide |
| SMILES | C[C@@H]1CCCN(Cc2ccc(C(=O)Nc3cc(Cl)ccc3Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C26H27ClN2O2/c1-19-6-5-15-29(17-19)18-20-9-11-21(12-10-20)26(30)28-24-16-22(27)13-14-25(24)31-23-7-3-2-4-8-23/h2-4,7-14,16,19H,5-6,15,17-18H2,1H3,(H,28,30)/t19-/m1/s1 |
| InChIKey | SJWOKKFWSDUUDT-LJQANCHMSA-N |
| XLogP | 6.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |