C26H35N3O4S — CID 46769837
N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-[(3-methylpiperidin-1-yl)methyl]benzamide (PubChem CID 46769837) has the molecular formula C26H35N3O4S and a molecular weight of 485.65 g/mol. Its IUPAC name is N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-[(3-methylpiperidin-1-yl)methyl]benzamide.
| Compound Name | N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-[(3-methylpiperidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 46769837 |
| Molecular Formula | C26H35N3O4S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-(2-methoxy-5-piperidin-1-ylsulfonylphenyl)-4-[(3-methylpiperidin-1-yl)methyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)c1ccc(CN2CCCC(C)C2)cc1 |
| InChI | InChI=1S/C26H35N3O4S/c1-20-7-6-14-28(18-20)19-21-8-10-22(11-9-21)26(30)27-24-17-23(12-13-25(24)33-2)34(31,32)29-15-4-3-5-16-29/h8-13,17,20H,3-7,14-16,18-19H2,1-2H3,(H,27,30) |
| InChIKey | ICGZOAPXGRRTAK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |