C24H21FN2O6S — CID 2385539
2-fluoro-N-(2-methoxydibenzofuran-3-yl)-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 2385539) has the molecular formula C24H21FN2O6S and a molecular weight of 484.51 g/mol. Its IUPAC name is 2-fluoro-N-(2-methoxydibenzofuran-3-yl)-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-fluoro-N-(2-methoxydibenzofuran-3-yl)-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2385539 |
| Molecular Formula | C24H21FN2O6S |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 2-fluoro-N-(2-methoxydibenzofuran-3-yl)-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1cc2c(cc1NC(=O)c1cc(S(=O)(=O)N3CCOCC3)ccc1F)oc1ccccc12 |
| InChI | InChI=1S/C24H21FN2O6S/c1-31-23-13-17-16-4-2-3-5-21(16)33-22(17)14-20(23)26-24(28)18-12-15(6-7-19(18)25)34(29,30)27-8-10-32-11-9-27/h2-7,12-14H,8-11H2,1H3,(H,26,28) |
| InChIKey | RVBOVCXBNLHLKJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |