C22H21N3O6S — CID 36671668
N-(2-methoxydibenzofuran-3-yl)-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 36671668) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 36671668 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)c1cc(S(=O)(=O)N3CCOCC3)c[nH]1)oc1ccccc12 |
| InChI | InChI=1S/C22H21N3O6S/c1-29-21-11-16-15-4-2-3-5-19(15)31-20(16)12-17(21)24-22(26)18-10-14(13-23-18)32(27,28)25-6-8-30-9-7-25/h2-5,10-13,23H,6-9H2,1H3,(H,24,26) |
| InChIKey | GPXPVEGIXDKVFV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |