C16H17F2N3O4S2 — CID 36671680
N-[2-(difluoromethylsulfanyl)phenyl]-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 36671680) has the molecular formula C16H17F2N3O4S2 and a molecular weight of 417.46 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 36671680 |
| Molecular Formula | C16H17F2N3O4S2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1SC(F)F)c1cc(S(=O)(=O)N2CCOCC2)c[nH]1 |
| InChI | InChI=1S/C16H17F2N3O4S2/c17-16(18)26-14-4-2-1-3-12(14)20-15(22)13-9-11(10-19-13)27(23,24)21-5-7-25-8-6-21/h1-4,9-10,16,19H,5-8H2,(H,20,22) |
| InChIKey | HJXRRUZLVGRFSH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |