C19H19F3N2O4S2 — CID 16609512
4-morpholin-4-ylsulfonyl-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide (PubChem CID 16609512) has the molecular formula C19H19F3N2O4S2 and a molecular weight of 460.50 g/mol. Its IUPAC name is 4-morpholin-4-ylsulfonyl-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide.
| Compound Name | 4-morpholin-4-ylsulfonyl-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 16609512 |
| Molecular Formula | C19H19F3N2O4S2 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 4-morpholin-4-ylsulfonyl-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1SCC(F)(F)F)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H19F3N2O4S2/c20-19(21,22)13-29-17-4-2-1-3-16(17)23-18(25)14-5-7-15(8-6-14)30(26,27)24-9-11-28-12-10-24/h1-8H,9-13H2,(H,23,25) |
| InChIKey | MSFUJFFWSRDQOW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |