C19H22N2O6S2 — CID 55613517
N-(2-ethylsulfonylphenyl)-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 55613517) has the molecular formula C19H22N2O6S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-(2-ethylsulfonylphenyl)-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2-ethylsulfonylphenyl)-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55613517 |
| Molecular Formula | C19H22N2O6S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | N-(2-ethylsulfonylphenyl)-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1ccccc1NC(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H22N2O6S2/c1-2-28(23,24)18-6-4-3-5-17(18)20-19(22)15-7-9-16(10-8-15)29(25,26)21-11-13-27-14-12-21/h3-10H,2,11-14H2,1H3,(H,20,22) |
| InChIKey | BISAVANRKDDMMX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |