C26H27N3O5S — CID 55635484
3-benzamido-4-methyl-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]benzamide (PubChem CID 55635484) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is 3-benzamido-4-methyl-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]benzamide.
| Compound Name | 3-benzamido-4-methyl-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 55635484 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 3-benzamido-4-methyl-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O5S/c1-19-7-10-22(17-24(19)28-26(31)21-5-3-2-4-6-21)25(30)27-18-20-8-11-23(12-9-20)35(32,33)29-13-15-34-16-14-29/h2-12,17H,13-16,18H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | FUVKNZYQJWZNJN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |