C26H27N3O5S — CID 55631501
3-benzamido-4-methyl-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 55631501) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is 3-benzamido-4-methyl-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 3-benzamido-4-methyl-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 55631501 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 3-benzamido-4-methyl-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C)c(S(=O)(=O)N3CCOCC3)c2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O5S/c1-18-8-10-21(16-23(18)28-25(30)20-6-4-3-5-7-20)26(31)27-22-11-9-19(2)24(17-22)35(32,33)29-12-14-34-15-13-29/h3-11,16-17H,12-15H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | UUXNMJSXDWOCQA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |