C26H27N3O6S — CID 5084540
N-[2-[(4-methoxyphenyl)carbamoyl]phenyl]-4-methyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 5084540) has the molecular formula C26H27N3O6S and a molecular weight of 509.58 g/mol. Its IUPAC name is N-[2-[(4-methoxyphenyl)carbamoyl]phenyl]-4-methyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[2-[(4-methoxyphenyl)carbamoyl]phenyl]-4-methyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 5084540 |
| Molecular Formula | C26H27N3O6S |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[2-[(4-methoxyphenyl)carbamoyl]phenyl]-4-methyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2NC(=O)c2ccc(C)c(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C26H27N3O6S/c1-18-7-8-19(17-24(18)36(32,33)29-13-15-35-16-14-29)25(30)28-23-6-4-3-5-22(23)26(31)27-20-9-11-21(34-2)12-10-20/h3-12,17H,13-16H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | KRTXQEZEMMHLRO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |